1,1'-Thiocarbonyldiimidazole, 85%
cas: 6160-65-2 — see every product listed under this CAS number, including other names
1,1'-Thiocarbonyldiimidazole, 85% (CAS 6160-65-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A107641-1g |
| cas | 6160-65-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 548.38 Pln | |
| Ambeed | 500g | 2422.94 Pln | |
| Ambeed | 1kg | 3401.94 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 25g | 225.50 Pln | |
| BLDpharm | 100g | 580.93 Pln | |
| BLDpharm | 500g | 2608.00 Pln | |
| BLDpharm | 1kg | 3663.18 Pln |
properties
| purity | 85% |
|---|---|
| delivery time | 1-2 weeks |
Di(imidazol-1-yl)methanethione (CAS 6160-65-2) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: di(imidazol-1-yl)methanethione. InChIKey: RAFNCPHFRHZCPS-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | di(imidazol-1-yl)methanethione |
| InChIKey | RAFNCPHFRHZCPS-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C(=S)N2C=CN=C2 |
Computed by PubChem (NCBI)
