CAS 32362-88-2 appears in our catalog under these names: 1,2-Dihydro-5-(3-pyridinyl)-3h-1,2,4-triazole-3-thione, 95%, 5-(Pyridin-3-yl)-1h-1,2,4-triazole-3-thiol, 95%, 1,2-Dihydro-5-(3-pyridinyl)-3h-1,2,4-triazole-3-thione, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
5-pyridin-3-yl-1,2-dihydro-1,2,4-triazole-3-thione (CAS 32362-88-2) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: 5-pyridin-3-yl-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: GAYWCADKXYCKCG-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | 5-pyridin-3-yl-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | GAYWCADKXYCKCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)