CAS 1339559-47-5 appears in our catalog under these names: 5-(Pyrazin-2-yl)thiazol-2-amine, 98+%, 5-(Pyrazin-2-yl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-pyrazin-2-yl-1,3-thiazol-2-amine (CAS 1339559-47-5) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: 5-pyrazin-2-yl-1,3-thiazol-2-amine. InChIKey: VEBVOFWRSKHMGH-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | 5-pyrazin-2-yl-1,3-thiazol-2-amine |
| InChIKey | VEBVOFWRSKHMGH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=CN=C(S2)N |
Computed by PubChem (NCBI)