CAS 19847-11-1 is the registry number for 4-(Pyrazin-2-yl)thiazol-2-amine, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
4-pyrazin-2-yl-1,3-thiazol-2-amine (CAS 19847-11-1) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: 4-pyrazin-2-yl-1,3-thiazol-2-amine. InChIKey: ALNOTRTXCBNEIG-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | 4-pyrazin-2-yl-1,3-thiazol-2-amine |
| InChIKey | ALNOTRTXCBNEIG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)