CAS 25468-22-8 appears in our catalog under these names: 5-(Pyridin-2-yl)-1,3,4-thiadiazol-2-amine, 95+%, 5-(Pyridin-2-yl)-1,3,4-thiadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
5-pyridin-2-yl-1,3,4-thiadiazol-2-amine (CAS 25468-22-8) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: 5-pyridin-2-yl-1,3,4-thiadiazol-2-amine. InChIKey: XRSWPYZJJLNMNK-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | 5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
| InChIKey | XRSWPYZJJLNMNK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)