CAS 32362-89-3 appears in our catalog under these names: 5-(Pyridin-2-yl)-1H-1,2,4-triazole-3-thiol, 95%, 5-(Pyridin-2-yl)-1H-1,2,4-triazole-3-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-pyridin-2-yl-1,2-dihydro-1,2,4-triazole-3-thione (CAS 32362-89-3) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: 5-pyridin-2-yl-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: KQELXNGDFDVDMQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | 5-pyridin-2-yl-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | KQELXNGDFDVDMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)