cas: 22767-90-4 — see every product listed under this CAS number, including other names
1,1,1-Trifluoro-5,5-dimethyl-2,4-hexanedione, 97% (CAS 22767-90-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F001330-1G |
| cas | 22767-90-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 539.41 Pln | |
| Fluorochem | 25g | 2059.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione (CAS 22767-90-4) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione. InChIKey: BVPKYBMUQDZTJH-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione |
| InChIKey | BVPKYBMUQDZTJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)