CAS 461-92-7 appears in our catalog under these names: 1,1,1-Trifluoro-6-methylheptane-2,4-dione, 98%, 1,1,1–Trifluoro–6–methylheptane–2,4–dione, 1,1,1-Trifluoro-6-methylheptan-2,4-dione, 99+%, 99+%, 1,1,1-trifluoro-2-hydroxy-6-methylhept-2-en-4-one, 98%, 1,1,1-Trifluoro-6-methylheptane-2,4-dione, 99+%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g.
1,1,1-trifluoro-6-methylheptane-2,4-dione (CAS 461-92-7) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1,1,1-trifluoro-6-methylheptane-2,4-dione. InChIKey: XWBVTGFPQXBNOZ-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-6-methylheptane-2,4-dione |
| InChIKey | XWBVTGFPQXBNOZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)