CAS 104907-44-0 appears in our catalog under these names: 3-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 95%, 3-(Trifluoromethyl)cyclohexanecarboxylic acid, 98%, 98%, 3-(Trifluoromethyl)cyclohexanecarboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
3-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 104907-44-0) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 3-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: CJMWFGSSEGRSHR-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | CJMWFGSSEGRSHR-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)