CAS 22767-90-4 appears in our catalog under these names: 1,1,1-Trifluoro-5,5-dimethyl-2,4-hexanedione, 95%, 1,1,1–Trifluoro–5,5–dimethyl–2,4–hexanedione, 1,1,1-Trifluoro-5,5-dimethyl-2,4-hexanedione, 95% , 1,1,1-TRIFLUORO-5,5-DIMETHYL-2,4-HEXANE&, 1,1,1-Trifluoro-5,5-dimethyl-2,4-hexanedione, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 1g, 5g, 5ML.
1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione (CAS 22767-90-4) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione. InChIKey: BVPKYBMUQDZTJH-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione |
| InChIKey | BVPKYBMUQDZTJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)