Products 384-20-3
CAS 384-20-3 appears in our catalog under these names: 2-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 97%, 2-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 2-(Trifluoromethyl)cyclohexanecarboxylic acid, 98%, 2-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 98+%. Offered by: Combi-blocks, Biosynth, Ambeed, BLDpharm, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 384-20-3) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 2-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: RAGWFGSHOZGADV-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 2-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | RAGWFGSHOZGADV-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)