CAS 180918-40-5 appears in our catalog under these names: 1-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 95%, 1-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 97+% , 1-(Trifluoromethyl)cyclohexane-1-carboxylic acid, 98%. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 100mg, 5g, 10g, 1g, 250mg.
1-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 180918-40-5) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: VFSFTDFBHSFDEE-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | VFSFTDFBHSFDEE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)