1,10-Phenanthroline-4,7-dicarboxylic acid, 95%
cas: 31301-31-2 — see every product listed under this CAS number, including other names
1,10-Phenanthroline-4,7-dicarboxylic acid, 95% (CAS 31301-31-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A250014-250mg |
| cas | 31301-31-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1037.88 Pln | |
| Ambeed | 1g | 1994.62 Pln | |
| Ambeed | 5g | 6071.94 Pln | |
| BLDpharm | 100mg | 808.63 Pln | |
| BLDpharm | 250mg | 1114.08 Pln | |
| BLDpharm | 1g | 2147.05 Pln | |
| BLDpharm | 5g | 6539.94 Pln | |
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 1725.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,10-phenanthroline-4,7-dicarboxylic acid (CAS 31301-31-2) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 1,10-phenanthroline-4,7-dicarboxylic acid. InChIKey: MBOIBXSDCWRKJR-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O4 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 1,10-phenanthroline-4,7-dicarboxylic acid |
| InChIKey | MBOIBXSDCWRKJR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C3=NC=CC(=C31)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
