CAS 31301-31-2 appears in our catalog under these names: 1,10–Phenanthroline–4,7–dicarboxylic acid, 1,10-Phenanthroline-4,7-dicarboxylic acid 95%, 1,10-Phenanthroline-4,7-dicarboxylic acid, 95%, 95%, 1,10-Phenanthroline-4,7-dicarboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
1,10-phenanthroline-4,7-dicarboxylic acid (CAS 31301-31-2) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 1,10-phenanthroline-4,7-dicarboxylic acid. InChIKey: MBOIBXSDCWRKJR-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O4 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 1,10-phenanthroline-4,7-dicarboxylic acid |
| InChIKey | MBOIBXSDCWRKJR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C3=NC=CC(=C31)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)