cas: 933752-32-0 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid 95% (CAS 933752-32-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273388-100mg |
| cas | 933752-32-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A273388 |
1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid (CAS 933752-32-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid. InChIKey: QEMYLDYQDFRTRT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid |
| InChIKey | QEMYLDYQDFRTRT-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)