cas: 22048-88-0 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroquinoline-7-carboxylic acid, 98%, 98% (CAS 22048-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BHPI-100mg |
| cas | 22048-88-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 616.40 Pln | |
| Chemat | 250mg | 1000.40 Pln | |
| Chemat | 1g | 2594.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,3,4-tetrahydroquinoline-7-carboxylic acid (CAS 22048-88-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinoline-7-carboxylic acid. InChIKey: JWFQTXPQWRCFMR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinoline-7-carboxylic acid |
| InChIKey | JWFQTXPQWRCFMR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C(=O)O)NC1 |
Computed by PubChem (NCBI)