cas: 40991-34-2 — see every product listed under this CAS number, including other names
1,2-BENZISOTHIAZOLE-3-CARBOXYLIC ACID, 98%, 98% (CAS 40991-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch129S5Q-100mg |
| cas | 40991-34-2 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 500mg | 174.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 10g | 1038.80 Pln | |
| Chemat | 25g | 2032.40 Pln | |
| Chemat | 50g | 3213.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2-benzothiazole-3-carboxylic acid (CAS 40991-34-2) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 1,2-benzothiazole-3-carboxylic acid. InChIKey: KTORKRBAIRTBCP-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 1,2-benzothiazole-3-carboxylic acid |
| InChIKey | KTORKRBAIRTBCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2)C(=O)O |
Computed by PubChem (NCBI)