Products 56910-99-7
CAS 56910-99-7 appears in our catalog under these names: 4-Carboxy-2,1-benzisothiazol, 95%, Benzo(c)isothiazole–4–carboxylic acid, 4-carboxy-2,1-benzisothiazol. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g.
2,1-benzothiazole-4-carboxylic acid (CAS 56910-99-7) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 2,1-benzothiazole-4-carboxylic acid. InChIKey: YAFYLKLDOSWFAI-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 2,1-benzothiazole-4-carboxylic acid |
| InChIKey | YAFYLKLDOSWFAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSC=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)