CAS 86236-37-5 appears in our catalog under these names: Thieno[3,2-c]pyridine-2-carboxylic acid, 98%, Thieno(3,2-c)pyridine-2-carboxylic acid, Thieno[3,2-c]pyridine-2-carboxylic acid 98%, Thieno[3,2-c]pyridine-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg, 0,5g, 50mg.
Thieno[3,2-c]pyridine-2-carboxylic acid (CAS 86236-37-5) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: thieno[3,2-c]pyridine-2-carboxylic acid. InChIKey: VKOINCMQZKBKHH-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2S |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | thieno[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | VKOINCMQZKBKHH-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1SC(=C2)C(=O)O |
Computed by PubChem (NCBI)