1,2-Bis(3-bromophenyl)ethane-1,2-dione, 98%
cas: 91960-97-3 — see every product listed under this CAS number, including other names
1,2-Bis(3-bromophenyl)ethane-1,2-dione, 98% (CAS 91960-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F693827-100MG |
| cas | 91960-97-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 242.64 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 5g | 2460.61 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 665.19 Pln | |
| Ambeed | 5g | 2389.56 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 714.22 Pln | |
| BLDpharm | 5g | 2569.12 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 1931.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1,2-bis(3-bromophenyl)ethane-1,2-dione (CAS 91960-97-3) is a chemical compound with the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. IUPAC name: 1,2-bis(3-bromophenyl)ethane-1,2-dione. InChIKey: XDYSRWNBAYVIGW-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O2 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | 1,2-bis(3-bromophenyl)ethane-1,2-dione |
| InChIKey | XDYSRWNBAYVIGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)