Products 1919799-35-1
CAS 1919799-35-1 is the registry number for 4,4'-Dibromo-[1,1'-biphenyl]-3,3'-dicarbaldehyde 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-5-(4-bromo-3-formylphenyl)benzaldehyde (CAS 1919799-35-1) is a chemical compound with the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. IUPAC name: 2-bromo-5-(4-bromo-3-formylphenyl)benzaldehyde. InChIKey: IEHHMFRFBLTOBR-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O2 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | 2-bromo-5-(4-bromo-3-formylphenyl)benzaldehyde |
| InChIKey | IEHHMFRFBLTOBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)Br)C=O)C=O)Br |
Computed by PubChem (NCBI)