CAS 952054-63-6 is the registry number for 3,6–Dibromophenanthrene–9,10–diol. Offered by: GLPBio. Available pack sizes: 1g.
3,6-dibromophenanthrene-9,10-diol (CAS 952054-63-6) is a chemical compound with the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. IUPAC name: 3,6-dibromophenanthrene-9,10-diol. InChIKey: CUZJAXLKPHDFMF-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O2 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | 3,6-dibromophenanthrene-9,10-diol |
| InChIKey | CUZJAXLKPHDFMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(C=CC(=C3)Br)C(=C2O)O |
Computed by PubChem (NCBI)