Products 1397972-08-5

CAS 1397972-08-5 is the registry number for 3,7-Dibromoanthracene-2,6-diol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3,7-dibromoanthracene-2,6-diol (CAS 1397972-08-5) is a chemical compound with the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. IUPAC name: 3,7-dibromoanthracene-2,6-diol. InChIKey: BUKABIUFQWFRPD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8Br2O2
Molecular weight368.02 g/mol
IUPAC name3,7-dibromoanthracene-2,6-diol
InChIKeyBUKABIUFQWFRPD-UHFFFAOYSA-N
SMILESC1=C2C=C(C(=CC2=CC3=CC(=C(C=C31)Br)O)Br)O

Computed by PubChem (NCBI)