CAS 51073-15-5 appears in our catalog under these names: Benzbromarone Impurity 1, Benzbromarone Impurity 4, 4-(2-Benzofuranyl)-2,6-dibromo-phenol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
4-(1-benzofuran-2-yl)-2,6-dibromophenol (CAS 51073-15-5) is a chemical compound with the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. IUPAC name: 4-(1-benzofuran-2-yl)-2,6-dibromophenol. InChIKey: UOWKCNPTYNCCGA-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O2 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | 4-(1-benzofuran-2-yl)-2,6-dibromophenol |
| InChIKey | UOWKCNPTYNCCGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=CC(=C(C(=C3)Br)O)Br |
Computed by PubChem (NCBI)