CAS 91960-97-3 appears in our catalog under these names: 1,2–Bis(3–bromophenyl)ethane–1,2–dione, 1,2-Bis(3-bromophenyl)ethane-1,2-dione 98%, 1,2-Bis(3-bromophenyl)ethane-1,2-dione, 98%, 1,2-Bis(3-bromophenyl)ethane-1,2-dione, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g.
1,2-bis(3-bromophenyl)ethane-1,2-dione (CAS 91960-97-3) is a chemical compound with the molecular formula C14H8Br2O2 and a molecular weight of 368.02 g/mol. IUPAC name: 1,2-bis(3-bromophenyl)ethane-1,2-dione. InChIKey: XDYSRWNBAYVIGW-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O2 |
|---|---|
| Molecular weight | 368.02 g/mol |
| IUPAC name | 1,2-bis(3-bromophenyl)ethane-1,2-dione |
| InChIKey | XDYSRWNBAYVIGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)