CAS 124842-96-2 appears in our catalog under these names: 1,2-Di-p-tolylethylenediamine, 95+%, 1,2-Di-p-tolylethylenediamine, >97%, >97%, 1,2-Di-p-tolylethane-1,2-diamine, >97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
1,2-bis(4-methylphenyl)ethane-1,2-diamine (CAS 124842-96-2) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 1,2-bis(4-methylphenyl)ethane-1,2-diamine. InChIKey: UQUZLWQGLCLOBD-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 1,2-bis(4-methylphenyl)ethane-1,2-diamine |
| InChIKey | UQUZLWQGLCLOBD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(C2=CC=C(C=C2)C)N)N |
Computed by PubChem (NCBI)