CAS 50764-59-5 appears in our catalog under these names: (1R,2S)-1,2-Di-p-tolylethane-1,2-diamine, 98%, (1R,2S)-1,2-Di-p-tolylethane-1,2-diamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
(1R,2S)-1,2-bis(4-methylphenyl)ethane-1,2-diamine (CAS 50764-59-5) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1R,2S)-1,2-bis(4-methylphenyl)ethane-1,2-diamine. InChIKey: UQUZLWQGLCLOBD-IYBDPMFKSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1R,2S)-1,2-bis(4-methylphenyl)ethane-1,2-diamine |
| InChIKey | UQUZLWQGLCLOBD-IYBDPMFKSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]([C@H](C2=CC=C(C=C2)C)N)N |
Computed by PubChem (NCBI)