CAS 162490-70-2 appears in our catalog under these names: (1S,2S)-1,2-Di-p-tolylethane-1,2-diamine, 97%, (1S,2S)–1,2–di–p–tolylethane–1,2–diamine, (1S,2S)-1,2-di-p-tolylethane-1,2-diamine, ≥97%(HPLC),≥99%(ee), ≥97%(HPLC),≥99%(ee). Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 500mg.
(1S,2S)-1,2-bis(4-methylphenyl)ethane-1,2-diamine (CAS 162490-70-2) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1S,2S)-1,2-bis(4-methylphenyl)ethane-1,2-diamine. InChIKey: UQUZLWQGLCLOBD-HOTGVXAUSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(4-methylphenyl)ethane-1,2-diamine |
| InChIKey | UQUZLWQGLCLOBD-HOTGVXAUSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H]([C@H](C2=CC=C(C=C2)C)N)N |
Computed by PubChem (NCBI)