CAS 60508-97-6 appears in our catalog under these names: (1S,2S)-(-)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine, 95%, (1S,2S)-N,N'-DIMETHYL-1,2-DIPHENYL-1,2-E. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 1g.
(1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 60508-97-6) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: BTHYVQUNQHWNLS-HOTGVXAUSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | BTHYVQUNQHWNLS-HOTGVXAUSA-N |
| SMILES | CN[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)NC |
Computed by PubChem (NCBI)