CAS 118628-68-5 appears in our catalog under these names: (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenylethylenediamine, 97%, (1R,2R)–N,N′–Dimethyl–1,2–diphenylethane–1,2–diamine, (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine, 99%, (1R,2R)-N,N'-DIMETHYL-1,2-DIPHENYLETHANE, (1R,2R)-N1,N2-DIMETHYL-1,2-DIPHENYLETHANE-1,2-DIAMINE, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Sigma-Aldrich, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 25g, 10g.
(1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 118628-68-5) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: BTHYVQUNQHWNLS-HZPDHXFCSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1R,2R)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | BTHYVQUNQHWNLS-HZPDHXFCSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)NC |
Computed by PubChem (NCBI)