CAS 54628-21-6 appears in our catalog under these names: 4,4'-Diamino-2,2'-dimethylbibenzyl, 95%, 4,4'-(Ethane-1,2-diyl)bis(3-methylaniline), 95+%, 4,4'–Diamino–2,2'–dimethylbibenzyl, 4,4'-Diamino-2,2'-dimethylbibenzyl, >98.0%(T)(GC), 4,4'-Diamino-2,2'-dimethylbibenzyl, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline (CAS 54628-21-6) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline. InChIKey: ISESBQNCWCFFFR-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 4-[2-(4-amino-2-methylphenyl)ethyl]-3-methylaniline |
| InChIKey | ISESBQNCWCFFFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)CCC2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)