cas: 400-65-7 — see every product listed under this CAS number, including other names
1,2-Dichloro-5-nitro-3-(trifluoromethyl)benzene, 97% (CAS 400-65-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091924-1G |
| cas | 400-65-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 10g | 331.15 Pln | |
| Fluorochem | 25g | 690.40 Pln | |
| Fluorochem | 100g | 2424.16 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene (CAS 400-65-7) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene. InChIKey: DPOBIBPWXIPEHF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene |
| InChIKey | DPOBIBPWXIPEHF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)