cas: 400-65-7 — see every product listed under this CAS number, including other names
2,3-Dichloro-5-nitrobenzotrifluoride, 98%, 98% (CAS 400-65-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148I2-1g |
| cas | 400-65-7 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 443.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene (CAS 400-65-7) is a chemical compound with the molecular formula C7H2Cl2F3NO2 and a molecular weight of 259.99 g/mol. IUPAC name: 1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene. InChIKey: DPOBIBPWXIPEHF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3NO2 |
|---|---|
| Molecular weight | 259.99 g/mol |
| IUPAC name | 1,2-dichloro-5-nitro-3-(trifluoromethyl)benzene |
| InChIKey | DPOBIBPWXIPEHF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)