1,2-Dimethyl 4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phthalate, 97%
cas: 2157414-14-5 — see every product listed under this CAS number, including other names
1,2-Dimethyl 4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phthalate, 97% (CAS 2157414-14-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A658384-250mg |
| cas | 2157414-14-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1421.69 Pln | |
| Ambeed | 25g | 4570.06 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 497.63 Pln | |
| BLDpharm | 5g | 1525.04 Pln | |
| BLDpharm | 25g | 4918.29 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 837.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-dicarboxylate (CAS 2157414-14-5) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-dicarboxylate. InChIKey: RLDRAXBPIRSRSV-UHFFFAOYSA-N.
| Molecular formula | C16H21BO6 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-dicarboxylate |
| InChIKey | RLDRAXBPIRSRSV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)