CAS 1073355-18-6 is the registry number for 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1073355-18-6) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: methyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: ZUWNUDWHBMLHSH-UHFFFAOYSA-N.
| Molecular formula | C16H21BO6 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | methyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | ZUWNUDWHBMLHSH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)