Products 1073355-18-6

CAS 1073355-18-6 is the registry number for 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1073355-18-6) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: methyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: ZUWNUDWHBMLHSH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21BO6
Molecular weight320.1 g/mol
IUPAC namemethyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
InChIKeyZUWNUDWHBMLHSH-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OC)OC(=O)C

Computed by PubChem (NCBI)