CAS 2130752-10-0 is the registry number for 4-Formyl-2-methoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-formyl-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 2130752-10-0) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: [4-formyl-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: VSDIFMHQXZYEMV-UHFFFAOYSA-N.
| Molecular formula | C16H21BO6 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | [4-formyl-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| InChIKey | VSDIFMHQXZYEMV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C=O)OC)OC(=O)C |
Computed by PubChem (NCBI)