CAS 1150271-68-3 is the registry number for 2,3-Methylenedioxo-5-(methoxycarbonyl)methylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]acetate (CAS 1150271-68-3) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: methyl 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]acetate. InChIKey: WOHOTRCEMIIOEP-UHFFFAOYSA-N.
| Molecular formula | C16H21BO6 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | methyl 2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxol-5-yl]acetate |
| InChIKey | WOHOTRCEMIIOEP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2OCO3)CC(=O)OC |
Computed by PubChem (NCBI)