CAS 2377611-62-4 appears in our catalog under these names: 3-Acetoxy-5-(methoxycarbonyl)phenylboronic acid pinacol ester, 95%, Methyl 3-acetoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
Methyl 3-acetyloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2377611-62-4) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: methyl 3-acetyloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: FGNZEGMVHABYMA-UHFFFAOYSA-N.
| Molecular formula | C16H21BO6 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | methyl 3-acetyloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | FGNZEGMVHABYMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(=O)C)C(=O)OC |
Computed by PubChem (NCBI)