CAS 1186377-08-1 appears in our catalog under these names: Dimethyl 2–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)terephthalate, Dimethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)terephthalate, 95%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
Dimethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,4-dicarboxylate (CAS 1186377-08-1) is a chemical compound with the molecular formula C16H21BO6 and a molecular weight of 320.1 g/mol. IUPAC name: dimethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,4-dicarboxylate. InChIKey: ZDIIHFUQYYAUAD-UHFFFAOYSA-N.
| Molecular formula | C16H21BO6 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | dimethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,4-dicarboxylate |
| InChIKey | ZDIIHFUQYYAUAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)