cas: 71989-31-6 — see every product listed under this CAS number, including other names
1,2-Pyrrolidinedicarboxylic acid, 1-(9H-fluoren-9-ylmethyl) ester, (2S)-, 98%, 98% (CAS 71989-31-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 250g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QO1-5g |
| cas | 71989-31-6 |
| size | 5g |
| availability | 50000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 250g | 256.40 Pln | |
| Chemat | 500g | 508.80 Pln | |
| Chemat | 1kg | 851.60 Pln | |
| Chemat | 5kg | 4315.20 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 71989-31-6) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: ZPGDWQNBZYOZTI-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ZPGDWQNBZYOZTI-SFHVURJKSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)