cas: 71989-31-6 — see every product listed under this CAS number, including other names
Fmoc-Pro-OH, 99.00% (CAS 71989-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM22650M-100g |
| cas | 71989-31-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 577.45 Pln | |
| Chemat | 250g | 1021.37 Pln | |
| Chemat | 25g | 261.54 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.00% |
| category | Chemicals |
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 71989-31-6) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: ZPGDWQNBZYOZTI-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ZPGDWQNBZYOZTI-SFHVURJKSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)