cas: 25357-95-3 — see every product listed under this CAS number, including other names
Cyclohexane-1,3,5-tricarboxylic acid 98% (CAS 25357-95-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182041-250mg |
| cas | 25357-95-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1566.31 Pln | |
| Ambeed | 10g | 2606.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182041 |
Cyclohexane-1,3,5-tricarboxylic acid (CAS 25357-95-3) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: cyclohexane-1,3,5-tricarboxylic acid. InChIKey: FTHDNRBKSLBLDA-UHFFFAOYSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | cyclohexane-1,3,5-tricarboxylic acid |
| InChIKey | FTHDNRBKSLBLDA-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)