cas: 25357-95-3 — see every product listed under this CAS number, including other names
Cyclohexane-1,3,5-tricarboxylic acid (CAS 25357-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624403-100MG |
| cas | 25357-95-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1580.71 Pln |
| delivery time | 3-4 weeks |
|---|
Cyclohexane-1,3,5-tricarboxylic acid (CAS 25357-95-3) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: cyclohexane-1,3,5-tricarboxylic acid. InChIKey: FTHDNRBKSLBLDA-UHFFFAOYSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | cyclohexane-1,3,5-tricarboxylic acid |
| InChIKey | FTHDNRBKSLBLDA-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)