cas: 25357-95-3 — see every product listed under this CAS number, including other names
Cyclohexane-1,3,5-tricarboxylic acid, 98%, 98% (CAS 25357-95-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DG8-250mg |
| cas | 25357-95-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Cyclohexane-1,3,5-tricarboxylic acid (CAS 25357-95-3) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: cyclohexane-1,3,5-tricarboxylic acid. InChIKey: FTHDNRBKSLBLDA-UHFFFAOYSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | cyclohexane-1,3,5-tricarboxylic acid |
| InChIKey | FTHDNRBKSLBLDA-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)