1,3,5-Triphenylbenzene, 95%
cas: 612-71-5 — see every product listed under this CAS number, including other names
1,3,5-Triphenylbenzene, 95% (CAS 612-71-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A991287-5g |
| cas | 612-71-5 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 431.56 Pln | |
| Ambeed | 500g | 1655.31 Pln | |
| Ambeed | 1kg | 2612.06 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 458.75 Pln | |
| BLDpharm | 500g | 1780.51 Pln | |
| BLDpharm | 1kg | 2807.92 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1,3,5-triphenylbenzene (CAS 612-71-5) is a chemical compound with the molecular formula C24H18 and a molecular weight of 306.4 g/mol. IUPAC name: 1,3,5-triphenylbenzene. InChIKey: SXWIAEOZZQADEY-UHFFFAOYSA-N.
| Molecular formula | C24H18 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1,3,5-triphenylbenzene |
| InChIKey | SXWIAEOZZQADEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)