CAS 135-70-6 appears in our catalog under these names: P-Quaterphenyl, 97%, P-Quaterphenyl, >95% (HPLC), p–Quaterphenyl, 1,1':4',1'':4'',1'''-Quaterphenyl, p-Quaterphenyl, >98.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 5g, 100mg, 10mg, 50mg, 2g, 10g.
P-quaterphenyl is a benzenoid aromatic compound that consists of four phenyl groups connected to each other in the para position. It has a role as a chromophore.
Source: ChEBI
| Molecular formula | C24H18 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-phenyl-4-(4-phenylphenyl)benzene |
| InChIKey | GPRIERYVMZVKTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)