CAS 1165-14-6 is the registry number for 2'-Phenyl-m-terphenyl. Offered by: TRC. Available pack sizes: 250mg, 25mg.
1,2,3-triphenylbenzene (CAS 1165-14-6) is a chemical compound with the molecular formula C24H18 and a molecular weight of 306.4 g/mol. IUPAC name: 1,2,3-triphenylbenzene. InChIKey: CHBDXRNMDNRJJC-UHFFFAOYSA-N.
| Molecular formula | C24H18 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1,2,3-triphenylbenzene |
| InChIKey | CHBDXRNMDNRJJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)