CAS 1166-19-4 is the registry number for m,p-Quaterphenyl, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
1-phenyl-3-(4-phenylphenyl)benzene (CAS 1166-19-4) is a chemical compound with the molecular formula C24H18 and a molecular weight of 306.4 g/mol. IUPAC name: 1-phenyl-3-(4-phenylphenyl)benzene. InChIKey: JQGLMRCAOAALPG-UHFFFAOYSA-N.
| Molecular formula | C24H18 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-phenyl-3-(4-phenylphenyl)benzene |
| InChIKey | JQGLMRCAOAALPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC(=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)