CAS 1165-53-3 appears in our catalog under these names: 1,2,4-Triphenylbenzene, 95%, 1,2,4–Triphenylbenzene, 1,2,4-Triphenylbenzene, >97.0%(GC), 4'-Phenyl-1,1':2',1''-terphenyl, 97.0%, 97.0%, 1,2,4-Triphenylbenzene, ≥97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 200mg.
1,2,4-triphenylbenzene (CAS 1165-53-3) is a chemical compound with the molecular formula C24H18 and a molecular weight of 306.4 g/mol. IUPAC name: 1,2,4-triphenylbenzene. InChIKey: XXCVBOQRPQKVKY-UHFFFAOYSA-N.
| Molecular formula | C24H18 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1,2,4-triphenylbenzene |
| InChIKey | XXCVBOQRPQKVKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)