CAS 28591-78-8 is the registry number for 9-(Diphenylmethylene)-1,4-dihydro-1,4-methanonaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
11-benzhydrylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (CAS 28591-78-8) is a chemical compound with the molecular formula C24H18 and a molecular weight of 306.4 g/mol. IUPAC name: 11-benzhydrylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene. InChIKey: DUTRHTRSYIPVPQ-UHFFFAOYSA-N.
| Molecular formula | C24H18 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 11-benzhydrylidenetricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| InChIKey | DUTRHTRSYIPVPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C2C3C=CC2C4=CC=CC=C34)C5=CC=CC=C5 |
Computed by PubChem (NCBI)